Availability: | |
---|---|
PDF Export | |
756-13-8
bosschemical
756-13-8
Perfluoro(2-methyl-3-pentanone) Basic information | |
Product Name: | Perfluoro(2-methyl-3-pentanone) |
CAS: | 756-13-8 |
MF: | C6F12O |
MW: | 316.04 |
EINECS: | 436-710-6 |
Mol File: | 756-13-8.mol |
Perfluoro(2-methyl-3-pentanone) Chemical Properties | |
Melting point | -108°C |
Boiling point | 49°C |
density | 1,6 g/cm3 |
vapor pressure | 31.6-40.4kPa at 20-25℃ |
solubility | Chloroform (Soluble), Methanol (Sparingly) |
form | clear liquid |
color | Colorless to Almost colorless |
Specific Gravity | 1.6 |
Water Solubility | 24-332.6mg/L at 25℃ |
InChI | InChI=1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
InChIKey | RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
SMILES | C(F)(F)(F)C(F)(F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
LogP | 2.79-5.48 at 20-25℃ |
EPA Substance Registry System | 3-Pentanone, 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)- (756-13-8) |
Perfluoro(2-methyl-3-pentanone) Basic information | |
Product Name: | Perfluoro(2-methyl-3-pentanone) |
CAS: | 756-13-8 |
MF: | C6F12O |
MW: | 316.04 |
EINECS: | 436-710-6 |
Mol File: | 756-13-8.mol |
Perfluoro(2-methyl-3-pentanone) Chemical Properties | |
Melting point | -108°C |
Boiling point | 49°C |
density | 1,6 g/cm3 |
vapor pressure | 31.6-40.4kPa at 20-25℃ |
solubility | Chloroform (Soluble), Methanol (Sparingly) |
form | clear liquid |
color | Colorless to Almost colorless |
Specific Gravity | 1.6 |
Water Solubility | 24-332.6mg/L at 25℃ |
InChI | InChI=1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
InChIKey | RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
SMILES | C(F)(F)(F)C(F)(F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
LogP | 2.79-5.48 at 20-25℃ |
EPA Substance Registry System | 3-Pentanone, 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)- (756-13-8) |