| Availability: | |
|---|---|
| PDF Export | |
5945-33-5
bosschemical
5945-33-5
| Bisphenol-A bis(diphenyl phosphate) Basic information | |
| Product Name: | Bisphenol-A bis(diphenyl phosphate) |
| CAS: | 5945-33-5 |
| MF: | C39H34O8P2 |
| MW: | 692.64 |
| EINECS: | 425-220-8 |
| Mol File: | 5945-33-5.mol |
| Bisphenol-A bis(diphenyl phosphate) Chemical Properties | |
| Boiling point | 679.6±48.0 °C(Predicted) |
| density | 1.283±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0.001Pa at 25℃ |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Off-White |
| Water Solubility | 415μg/L at 20℃ |
| InChIKey | BQPNUOYXSVUVMY-UHFFFAOYSA-N |
| SMILES | P(=O)(OC1C=CC=CC=1)(OC1C=CC=CC=1)OC1C=CC(C(C2C=CC(OP(=O)(OC3C=CC=CC=3)OC3C=CC=CC=3)=CC=2)(C)C)=CC=1 |
| LogP | 6 at 20℃ |
| EPA Substance Registry System | Phosphoric acid, (1-methylethylidene)di-4,1-phenylene tetraphenyl ester (5945-33-5) |


| Bisphenol-A bis(diphenyl phosphate) Basic information | |
| Product Name: | Bisphenol-A bis(diphenyl phosphate) |
| CAS: | 5945-33-5 |
| MF: | C39H34O8P2 |
| MW: | 692.64 |
| EINECS: | 425-220-8 |
| Mol File: | 5945-33-5.mol |
| Bisphenol-A bis(diphenyl phosphate) Chemical Properties | |
| Boiling point | 679.6±48.0 °C(Predicted) |
| density | 1.283±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0.001Pa at 25℃ |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Off-White |
| Water Solubility | 415μg/L at 20℃ |
| InChIKey | BQPNUOYXSVUVMY-UHFFFAOYSA-N |
| SMILES | P(=O)(OC1C=CC=CC=1)(OC1C=CC=CC=1)OC1C=CC(C(C2C=CC(OP(=O)(OC3C=CC=CC=3)OC3C=CC=CC=3)=CC=2)(C)C)=CC=1 |
| LogP | 6 at 20℃ |
| EPA Substance Registry System | Phosphoric acid, (1-methylethylidene)di-4,1-phenylene tetraphenyl ester (5945-33-5) |


