E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
830-09-1
bosschemical
830-09-1
| 4-Methoxycinnamic acid Basic information | |
| Product Name: | 4-Methoxycinnamic acid |
 CAS: | 830-09-1 |
| MF: | C10H10O3 |
| MW: | 178.18 |
| EINECS: | 212-594-0 |
| Mol File: | 830-09-1.mol |
| 4-Methoxycinnamic acid Chemical Properties | |
| Melting point | 173.5 °C(lit.) |
| Boiling point | 250.41°C (rough estimate) |
| density | 1.1479 (rough estimate) |
| refractive index | 1.5088 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| pka | pK1:4.539 (25°C) |
| form | Fine Crystalline Powder |
| color | White |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C=C1 |
| LogP | 2.68 |
| CAS DataBase Reference | 830-09-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-(830-09-1) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(4-methoxyphenyl)- (830-09-1) |
| 4-Methoxycinnamic acid Basic information | |
| Product Name: | 4-Methoxycinnamic acid |
| CAS: | 830-09-1 |
| MF: | C10H10O3 |
| MW: | 178.18 |
| EINECS: | 212-594-0 |
| Mol File: | 830-09-1.mol |
| 4-Methoxycinnamic acid Chemical Properties | |
| Melting point | 173.5 °C(lit.) |
| Boiling point | 250.41°C (rough estimate) |
| density | 1.1479 (rough estimate) |
| refractive index | 1.5088 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| pka | pK1:4.539 (25°C) |
| form | Fine Crystalline Powder |
| color | White |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C=C1 |
| LogP | 2.68 |
| CAS DataBase Reference | 830-09-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-(830-09-1) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(4-methoxyphenyl)- (830-09-1) |
