| Availability: | |
|---|---|
| PDF Export | |
2591-17-5
bosschemical
2591-17-5
| D-Luciferin Basic information | |
| Product Name: | D-Luciferin |
| 2591-17-5 | |
| MF: | C11H8N2O3S2 |
| MW: | 280.32 |
| EINECS: | 219-981-3 |
| Mol File: | 2591-17-5.mol |
| D-Luciferin Chemical Properties | |
| Melting point | 200-204 °C |
| alpha | D22 -36° (c = 1.2 in DMF) |
| Boiling point | 587.6±60.0 °C(Predicted) |
| density | 1.4916 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | -20°C |
| solubility | DMF:30.0(Max Conc. mg/mL);107.02(Max Conc. mM) |
| DMSO:35.33(Max Conc. mg/mL);126.05(Max Conc. mM) | |
| pka | 8.31±0.40(Predicted) |
| form | Powder |
| color | Off-white to light yellow |
| biological source | synthetic |
| λmax | 360nm(H2O)(lit.) |
| Merck | 144,086 |
| BRN | 30484 |
| InChI | InChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | BJGNCJDXODQBOB-SSDOTTSWSA-N |
| SMILES | S1C[C@H](C(O)=O)N=C1C1=NC2=CC=C(O)C=C2S1 |


| D-Luciferin Basic information | |
| Product Name: | D-Luciferin |
| 2591-17-5 | |
| MF: | C11H8N2O3S2 |
| MW: | 280.32 |
| EINECS: | 219-981-3 |
| Mol File: | 2591-17-5.mol |
| D-Luciferin Chemical Properties | |
| Melting point | 200-204 °C |
| alpha | D22 -36° (c = 1.2 in DMF) |
| Boiling point | 587.6±60.0 °C(Predicted) |
| density | 1.4916 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | -20°C |
| solubility | DMF:30.0(Max Conc. mg/mL);107.02(Max Conc. mM) |
| DMSO:35.33(Max Conc. mg/mL);126.05(Max Conc. mM) | |
| pka | 8.31±0.40(Predicted) |
| form | Powder |
| color | Off-white to light yellow |
| biological source | synthetic |
| λmax | 360nm(H2O)(lit.) |
| Merck | 144,086 |
| BRN | 30484 |
| InChI | InChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | BJGNCJDXODQBOB-SSDOTTSWSA-N |
| SMILES | S1C[C@H](C(O)=O)N=C1C1=NC2=CC=C(O)C=C2S1 |


