| Availability: | |
|---|---|
305-84-0
bosschemical
305-84-0
L-Carnosine Basic information | |
Product Name: | L-Carnosine |
CAS: | 305-84-0 |
MF: | C9H14N4O3 |
MW: | 226.23 |
EINECS: | 206-169-9 |
Mol File: | 305-84-0.mol |
L-Carnosine Chemical Properties | |
Melting point | 253 °C (dec.) (lit.) |
alpha | 20.9 º (c=1.5, H2O) |
Boiling point | 367.84°C (rough estimate) |
density | 1.2673 (rough estimate) |
vapor pressure | 0Pa at 25℃ |
refractive index | 21 ° (C=2, H2O) |
storage temp. | -20°C |
solubility | DMSO (Very Slightly), Water (Slightly) |
pka | 2.62(at 25℃) |
form | crystalline |
color | White |
Odor | at 100.00%. odorless |
Optical Rotation | 24.12 |
Water Solubility | almost transparency |
Merck | 141,850 |
BRN | 87671 |
Stability: | Stable, but may be heat sensitive - store cold. Incompatible with strong oxidizing agents. |
Major Application | food and beverages |
personal care | |
pharmaceutical | |
Cosmetics Ingredients Functions | SKIN CONDITIONING |
InChI | 1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
SMILES | NCCC(=O)N[C@@H](Cc1c[nH]cn1)C(O)=O |
LogP | -3.8 at 22℃ |
CAS DataBase Reference | 305-84-0(CAS DataBase Reference) |
EPA Substance Registry System | L-Histidine, .beta.-alanyl- (305-84-0) |
