| Availability: | |
|---|---|
| PDF Export | |
299-29-6
bosschemical
299-29-6
| Ferrous gluconate Basic information | |
| Product Name: | Ferrous gluconate |
| CAS: | 299-29-6 |
| MF: | C12H22FeO14 |
| MW: | 446.14 |
| EINECS: | 206-076-3 |
| Mol File: | 299-29-6.mol |
| Ferrous gluconate Chemical Properties | |
| density | 0.79[at 20℃] |
| vapor pressure | 2.399hPa at 10℃ |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Freely but slowly soluble in water giving a greenish-brown solution, more readily soluble in hot water, practically insoluble in ethanol (96 per cent). |
| pka | 6.28[at 20 ℃] |
| Odor | at 100.00?%. caramellic |
| Appearance | Off-white to light brown Solid |
| Water Solubility | 118g/L at 25℃ |
| Stability: | May be light-sensitive - store in the dark. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/2C6H12O7.Fe/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | VRIVJOXICYMTAG-UHFFFAOYSA-L |
| SMILES | C(C1C([O-][Fe+2]2([O-]C(C([OH]2)C(O)C(O)C(O)CO)=O)[OH]1)=O)(O)C(O)C(O)CO |
| LogP | -2.6 at 25℃ |
| CAS DataBase Reference | 299-29-6(CAS DataBase Reference) |
| EPA Substance Registry System | Iron, bis(D-gluconato-.kappa.O1,.kappa.O2)- (299-29-6) |


