| Availability: | |
|---|---|
| PDF Export | |
9003-55-8
Boss Chemical
9003-55-8
Styrene Butadiene Rubber Basic information | |
Product Name: | Styrene Butadiene Rubber |
CAS: | 9003-55-8 |
MF: | (C8H8.C4H6)x |
MW: | 158.24 |
EINECS: | 618-370-2 |
Mol File: | 9003-55-8.mol |
Styrene Butadiene Rubber Chemical Properties | |
Melting point | 253 °C |
density | 1.04 g/mL at 25 °C |
refractive index | 1.57 |
solubility | solvents with solubility parameters between 7.7 and 9.4: soluble |
form | slab/chunk |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
Cosmetics Ingredients Functions | OPACIFYING |
InChI | InChI=1S/C8H8.C4H6/c1-2-8-6-4-3-5-7-8;1-3-4-2/h2-7H,1H2;3-4H,1-2H2 |
InChIKey | MTAZNLWOLGHBHU-UHFFFAOYSA-N |
SMILES | C(=C)C=C.C(C1C=CC=CC=1)=C |
LogP | 2.700 (est) |
IARC | 3 (Vol. 19, Sup 7) 1987 |
EPA Substance Registry System | Styrene 1,3-butadiene polymer (9003-55-8) |
