| Availability: | |
|---|---|
| PDF Export | |
2156-56-1
bosschemical
2156-56-1
Sodium dichloroacetate Basic information | |
| Product Name: | Sodium dichloroacetate |
| CAS: | 2156-56-1 |
| MF: | C2H3Cl2NaO2 |
| MW: | 152.93 |
| EINECS: | 218-461-3 |
| Mol File: | 2156-56-1.mol |
| Sodium dichloroacetate Chemical Properties | |
| Melting point | 198 °C (dec.) (lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Powder |
| color | White |
| PH | 6.0 to 8.5(50g/L, 25 ℃) |
| Water Solubility | soluble in cold water |
| Sensitive | Moisture Sensitive |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C2H2Cl2O2.Na.H/c3-1(4)2(5)6;;/h1H,(H,5,6);; |
| InChIKey | LUPNKHXLFSSUGS-UHFFFAOYSA-M |
| SMILES | C(Cl)(Cl)C(=O)O.[NaH] |
| CAS DataBase Reference | 2156-56-1(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium dichloroacetate (2156-56-1) |


Sodium dichloroacetate Basic information | |
| Product Name: | Sodium dichloroacetate |
| CAS: | 2156-56-1 |
| MF: | C2H3Cl2NaO2 |
| MW: | 152.93 |
| EINECS: | 218-461-3 |
| Mol File: | 2156-56-1.mol |
| Sodium dichloroacetate Chemical Properties | |
| Melting point | 198 °C (dec.) (lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Powder |
| color | White |
| PH | 6.0 to 8.5(50g/L, 25 ℃) |
| Water Solubility | soluble in cold water |
| Sensitive | Moisture Sensitive |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C2H2Cl2O2.Na.H/c3-1(4)2(5)6;;/h1H,(H,5,6);; |
| InChIKey | LUPNKHXLFSSUGS-UHFFFAOYSA-M |
| SMILES | C(Cl)(Cl)C(=O)O.[NaH] |
| CAS DataBase Reference | 2156-56-1(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium dichloroacetate (2156-56-1) |


