| Availability: | |
|---|---|
| PDF Export | |
3896-11-5
bosschemical
3896-11-5
| UV Absorber 326 Basic information | |
| Product Name: | UV Absorber 326 |
| CAS: | 729335 |
| MF: | C17H18ClN3O |
| MW: | 315.8 |
| EINECS: | 223-445-4 |
| Mol File: | 3896-11-5.mol |
| UV Absorber 326 Chemical Properties | |
| Melting point | 144-147 °C(lit.) |
| Boiling point | 460.4±55.0 °C(Predicted) |
| density | 1.26±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 9.31±0.48(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 4μg/L at 20℃ |
| InChI | InChI=1S/C17H18ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-19-13-6-5-11(18)9-14(13)20-21/h5-9,22H,1-4H3 |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C)C=C1N1N=C2C=C(Cl)C=CC2=N1 |
| LogP | 6.580 (est) |
| CAS DataBase Reference | 3896-11-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-tert-Butyl-6-(5-chloro-2H-benzotriazol-2-yl)-p-cresol (3896-11-5) |


| UV Absorber 326 Basic information | |
| Product Name: | UV Absorber 326 |
| CAS: | 729335 |
| MF: | C17H18ClN3O |
| MW: | 315.8 |
| EINECS: | 223-445-4 |
| Mol File: | 3896-11-5.mol |
| UV Absorber 326 Chemical Properties | |
| Melting point | 144-147 °C(lit.) |
| Boiling point | 460.4±55.0 °C(Predicted) |
| density | 1.26±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 9.31±0.48(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 4μg/L at 20℃ |
| InChI | InChI=1S/C17H18ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-19-13-6-5-11(18)9-14(13)20-21/h5-9,22H,1-4H3 |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C)C=C1N1N=C2C=C(Cl)C=CC2=N1 |
| LogP | 6.580 (est) |
| CAS DataBase Reference | 3896-11-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-tert-Butyl-6-(5-chloro-2H-benzotriazol-2-yl)-p-cresol (3896-11-5) |


