E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
43210-67-9
bosschem
43210-67-9
| Fenbendazole Basic information | |
| Product Name: | Fenbendazole |
| Synonyms: | hoe881;Fenbedazole;5-(phenylthio)-2-benzimidazolecarbamic acid methyl ester;Methyl 5-phenylthio-1H-benaimidazol-2-yl carbamate;fenbendazol;Carbamic acid, 5-(phenylthio)-1H-benzimidazol-2-yl-, methyl ester;Febendazole;2-(Methoxycarbonylamino)-5-(phenylthio)benzimidazole |
| CAS: | 43210-67-9 |
| MF: | C15H13N3O2S |
| MW: | 299.35 |
| EINECS: | 256-145-7 |
| Product Categories: | ProteasomeInhibitors;Amines;Veterinaries;Aromatics;Heterocycles;Sulfur & Selenium Compounds;PHARMACEUTICALS;Active Pharmaceutical Ingredients;API;Intermediates & Fine Chemicals;PANACUR;Other APIs;vermifuge;43210-67-9 |
| Mol File: | 43210-67-9.mol |
| Fenbendazole Chemical Properties | |
| Melting point | 233°C |
| density | 1.2767 (rough estimate) |
| refractive index | 1.6740 (estimate) |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| solubility | DMSO:16.67(Max Conc. mg/mL);55.69(Max Conc. mM) |
| DMF:10.0(Max Conc. mg/mL);33.41(Max Conc. mM) | |
| pka | 10.80±0.10(Predicted) |
| form | neat |
| color | White to Light yellow |
| Merck | 143,960 |
| BRN | 759077 |
| InChI | InChI=1S/C15H13N3O2S/c1-20-15(19)18-14-16-12-8-7-11(9-13(12)17-14)21-10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | HDDSHPAODJUKPD-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)NC1NC2=CC(SC3=CC=CC=C3)=CC=C2N=1 |
| CAS DataBase Reference | 43210-67-9(CAS DataBase Reference) |
| EPA Substance Registry System | Carbamic acid, N-[6-(phenylthio)-1H-benzimidazol-2-yl]-, methyl ester (43210-67-9) |
| Fenbendazole Basic information | |
| Product Name: | Fenbendazole |
| Synonyms: | hoe881;Fenbedazole;5-(phenylthio)-2-benzimidazolecarbamic acid methyl ester;Methyl 5-phenylthio-1H-benaimidazol-2-yl carbamate;fenbendazol;Carbamic acid, 5-(phenylthio)-1H-benzimidazol-2-yl-, methyl ester;Febendazole;2-(Methoxycarbonylamino)-5-(phenylthio)benzimidazole |
| CAS: | 43210-67-9 |
| MF: | C15H13N3O2S |
| MW: | 299.35 |
| EINECS: | 256-145-7 |
| Product Categories: | ProteasomeInhibitors;Amines;Veterinaries;Aromatics;Heterocycles;Sulfur & Selenium Compounds;PHARMACEUTICALS;Active Pharmaceutical Ingredients;API;Intermediates & Fine Chemicals;PANACUR;Other APIs;vermifuge;43210-67-9 |
| Mol File: | 43210-67-9.mol |
| Fenbendazole Chemical Properties | |
| Melting point | 233°C |
| density | 1.2767 (rough estimate) |
| refractive index | 1.6740 (estimate) |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| solubility | DMSO:16.67(Max Conc. mg/mL);55.69(Max Conc. mM) |
| DMF:10.0(Max Conc. mg/mL);33.41(Max Conc. mM) | |
| pka | 10.80±0.10(Predicted) |
| form | neat |
| color | White to Light yellow |
| Merck | 143,960 |
| BRN | 759077 |
| InChI | InChI=1S/C15H13N3O2S/c1-20-15(19)18-14-16-12-8-7-11(9-13(12)17-14)21-10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | HDDSHPAODJUKPD-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)NC1NC2=CC(SC3=CC=CC=C3)=CC=C2N=1 |
| CAS DataBase Reference | 43210-67-9(CAS DataBase Reference) |
| EPA Substance Registry System | Carbamic acid, N-[6-(phenylthio)-1H-benzimidazol-2-yl]-, methyl ester (43210-67-9) |
