| Availability: | |
|---|---|
| PDF Export | |
520-34-3
bosschemical
520-34-3
Diosmetin Basic information | |
Product Name: | Diosmetin |
CAS: | 520-34-3 |
MF: | C16H12O6 |
MW: | 300.26 |
EINECS: | 208-291-8 |
Mol File: | 520-34-3.mol |
Diosmetin Chemical Properties | |
Melting point | 256-258°C |
Boiling point | 576.7±50.0 °C(Predicted) |
density | 1.512±0.06 g/cm3(Predicted) |
vapor pressure | 0Pa at 20℃ |
storage temp. | Sealed in dry,2-8°C |
solubility | Soluble in acetonitrile, DMSO (60 mg/ml), and ethanol (17 mg/ml), clear, light yellow to yellow. |
pka | 6.50±0.40(Predicted) |
form | Solid |
color | light yellow to yellow |
Water Solubility | 19μg/L at 20℃ |
BRN | 294492 |
Henry's Law Constant | 3.3×1012 mol/(m3Pa) at 25℃, HSDB (2015) |
Stability: | Hygroscopic |
Major Application | metabolomics |
vitamins, nutraceuticals, and natural products | |
Cosmetics Ingredients Functions | SKIN CONDITIONING |
InChI | 1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
InChIKey | MBNGWHIJMBWFHU-UHFFFAOYSA-N |
SMILES | COc1ccc(cc1O)C2=CC(=O)c3c(O)cc(O)cc3O2 |
LogP | 3.1 at 20℃ |
CAS DataBase Reference | 520-34-3(CAS DataBase Reference) |
