| Availability: | |
|---|---|
3144-16-9
bosschemical
3144-16-9
(1S)-(+)-Camphor-10-sulphonic acid Basic information | |
Synthesis | |
Product Name: | (1S)-(+)-Camphor-10-sulphonic acid |
CAS: | 3144-16-9 |
MF: | C10H16O4S |
MW: | 232.3 |
EINECS: | 221-554-1 |
Mol File: | 3144-16-9.mol |
(1S)-(+)-Camphor-10-sulphonic acid Chemical Properties | |
Melting point | 196-200 °C (dec.)(lit.) |
alpha | 22 º (589nm, c=20, H2O 25 ºC) |
Boiling point | 344.46°C (rough estimate) |
density | 1.2981 (rough estimate) |
refractive index | 21.5 ° (C=5, H2O) |
storage temp. | Store below +30°C. |
solubility | Exhibit moderate solubility in HCCl. |
pka | 1.17±0.50(Predicted) |
form | Crystalline Powder |
color | White to off-white |
PH | 0.3 (200g/l, H2O) |
Optical Rotation | [α]20/D +21.5±1°, c = 10% in H2O |
biological source | human |
Water Solubility | SOLUBLE |
Sensitive | Hygroscopic |
Merck | 141,734 |
BRN | 2809675 |
Stability: | Stable. Protect from moisture. Incompatible with strong oxidizing agents, strong bases. |
InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
CAS DataBase Reference | 3144-16-9(CAS DataBase Reference) |
EPA Substance Registry System | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- (3144-16-9) |
