E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
165252-70-0
bosschem
165252-70-0
| Dinotefuran Basic information | |
| Product Name: | Dinotefuran |
| Synonyms: | DINOTEFURAN;1-Methyl-2-nitro-3-((tetrahydrofuran-3-yl)Methyl)guanidine;Albarin;Mikeblock;N''-Methyl-N-nitro-N'-[(tetrahydro-3-furanyl)Methyl]guanidine;N-Methyl-N'-nitro-N''-[(tetrahydro-3-furanyl)Methyl]guanidine;Safari (insecticide);Starkle |
| CAS: | 165252-70-0 |
| MF: | C7H14N4O3 |
| MW: | 202.21 |
| EINECS: | 605-399-0 |
| Mol File: | 165252-70-0.mol |
| Dinotefuran Chemical Properties | |
| Melting point | 94.5-101.5° |
| Boiling point | 334.5±34.0 °C(Predicted) |
| density | 1.42±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 3.24±0.50(Predicted) |
| color | White to Pale Brown |
| Water Solubility | 39.83g/L at 20℃ |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| SMILES | N([N+]([O-])=O)C(=NC)NCC1CCOC1 |
| LogP | -0.64 at 25℃ |
| EPA Substance Registry System | Dinotefuran (165252-70-0) |
| Product Name | Dinotefuran |
| CAS NO. | 165252-70-0 |
| MF | C7H14N4O3 |
| Function | Insecticide |
| Application | Rice/wheat/cabbage/cucumber |
| Pest Control | Delphacidae/Whitefly/Pieris rapae |
| Attentions | The toxicity of dinotefuran to honeybees ranges from medium risk to high risk, and it is forbidden during the pollination and flowering period of plants. |
| Dinotefuran Basic information | |
| Product Name: | Dinotefuran |
| Synonyms: | DINOTEFURAN;1-Methyl-2-nitro-3-((tetrahydrofuran-3-yl)Methyl)guanidine;Albarin;Mikeblock;N''-Methyl-N-nitro-N'-[(tetrahydro-3-furanyl)Methyl]guanidine;N-Methyl-N'-nitro-N''-[(tetrahydro-3-furanyl)Methyl]guanidine;Safari (insecticide);Starkle |
| CAS: | 165252-70-0 |
| MF: | C7H14N4O3 |
| MW: | 202.21 |
| EINECS: | 605-399-0 |
| Mol File: | 165252-70-0.mol |
| Dinotefuran Chemical Properties | |
| Melting point | 94.5-101.5° |
| Boiling point | 334.5±34.0 °C(Predicted) |
| density | 1.42±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 3.24±0.50(Predicted) |
| color | White to Pale Brown |
| Water Solubility | 39.83g/L at 20℃ |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| SMILES | N([N+]([O-])=O)C(=NC)NCC1CCOC1 |
| LogP | -0.64 at 25℃ |
| EPA Substance Registry System | Dinotefuran (165252-70-0) |
| Product Name | Dinotefuran |
| CAS NO. | 165252-70-0 |
| MF | C7H14N4O3 |
| Function | Insecticide |
| Application | Rice/wheat/cabbage/cucumber |
| Pest Control | Delphacidae/Whitefly/Pieris rapae |
| Attentions | The toxicity of dinotefuran to honeybees ranges from medium risk to high risk, and it is forbidden during the pollination and flowering period of plants. |
