Availability: | |
---|---|
PDF Export | |
129938-20-1
bosschem
129938-20-1
Dapoxetine hydrochloride Basic information | |
Product Name: | Dapoxetine hydrochloride |
Synonyms: | DL-Dapoxteine HCL;N,N-DiMethyl-1-phenyl-3-(1-naphthalenyloxy)propanaMinehydrochloride;(S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-1-phenylpropan-1-amine hydrochloride;Dapoxetine/Dapoxetine HCl/Dapoxetine hydrochloride;LY-210448 hydrochloride;Priligy;PRILIGY;LY-210448 HYDROCHLORIDE;(S)-N,N-dimethyl-3- |
CAS: | 129938-20-1 |
MF: | C21H24ClNO |
MW: | 341.88 |
EINECS: | 640-411-8 |
Mol File: | 129938-20-1.mol |
Dapoxetine hydrochloride Chemical Properties | |
Melting point | 175-1790C |
alpha | D +135.78° (c = 2.18 in methanol) |
storage temp. | room temp |
solubility | DMSO: ≥20mg/mL |
form | powder |
color | white |
optical activity | [α]/D +125 to +135°, c = 1 in methanol |
Merck | 142,821 |
InChI | InChI=1/C21H23NO.ClH/c1-22(2)20(18-10-4-3-5-11-18)15-16-23-21-14-8-12-17-9-6-7-13-19(17)21;/h3-14,20H,15-16H2,1-2H3;1H/t20-;/s3 |
InChIKey | IHWDIQRWYNMKFM-OZYVVJTJNA-N |
SMILES | O(C1=CC=CC2C=CC=CC1=2)CC[C@@H](C1C=CC=CC=1)N(C)C.Cl |&1:13,r| |
CAS DataBase Reference | 129938-20-1(CAS DataBase Reference) |
Dapoxetine hydrochloride Basic information | |
Product Name: | Dapoxetine hydrochloride |
Synonyms: | DL-Dapoxteine HCL;N,N-DiMethyl-1-phenyl-3-(1-naphthalenyloxy)propanaMinehydrochloride;(S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-1-phenylpropan-1-amine hydrochloride;Dapoxetine/Dapoxetine HCl/Dapoxetine hydrochloride;LY-210448 hydrochloride;Priligy;PRILIGY;LY-210448 HYDROCHLORIDE;(S)-N,N-dimethyl-3- |
CAS: | 129938-20-1 |
MF: | C21H24ClNO |
MW: | 341.88 |
EINECS: | 640-411-8 |
Mol File: | 129938-20-1.mol |
Dapoxetine hydrochloride Chemical Properties | |
Melting point | 175-1790C |
alpha | D +135.78° (c = 2.18 in methanol) |
storage temp. | room temp |
solubility | DMSO: ≥20mg/mL |
form | powder |
color | white |
optical activity | [α]/D +125 to +135°, c = 1 in methanol |
Merck | 142,821 |
InChI | InChI=1/C21H23NO.ClH/c1-22(2)20(18-10-4-3-5-11-18)15-16-23-21-14-8-12-17-9-6-7-13-19(17)21;/h3-14,20H,15-16H2,1-2H3;1H/t20-;/s3 |
InChIKey | IHWDIQRWYNMKFM-OZYVVJTJNA-N |
SMILES | O(C1=CC=CC2C=CC=CC1=2)CC[C@@H](C1C=CC=CC=1)N(C)C.Cl |&1:13,r| |
CAS DataBase Reference | 129938-20-1(CAS DataBase Reference) |