E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
5026-62-0
bosschem
5026-62-0
| Sodium methylparaben Basic information | |
| Product Name: | Sodium methylparaben |
| CAS: | 5026-62-0 |
| MF: | C8H9NaO3 |
| MW: | 176.15 |
| EINECS: | 225-714-1 |
| Mol File: | 5026-62-0.mol |
| Sodium methylparaben Chemical Properties | |
| Melting point | >125°C |
| density | 1.42 g/cm3 (20 °C) |
| storage temp. | Store at +15°C to +25°C. |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| pka | 8.4[at 20 ℃] |
| form | Powder |
| color | White |
| PH | 9.7-10.3 (1g/l, H2O) |
| Water Solubility | 418g/L at 20℃ |
| BRN | 4165000 |
| InChI | InChI=1S/C8H8O3.Na.H/c1-11-8(10)6-2-4-7(9)5-3-6;;/h2-5,9H,1H3;; |
| InChIKey | PESXGULMKCKJCC-UHFFFAOYSA-M |
| SMILES | C(C1C=CC(O)=CC=1)(=O)OC.[NaH] |
| LogP | -0.63 at 20℃ |
| CAS DataBase Reference | 5026-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | Methylparaben sodium (5026-62-0) |
| Sodium methylparaben Basic information | |
| Product Name: | Sodium methylparaben |
| CAS: | 5026-62-0 |
| MF: | C8H9NaO3 |
| MW: | 176.15 |
| EINECS: | 225-714-1 |
| Mol File: | 5026-62-0.mol |
| Sodium methylparaben Chemical Properties | |
| Melting point | >125°C |
| density | 1.42 g/cm3 (20 °C) |
| storage temp. | Store at +15°C to +25°C. |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| pka | 8.4[at 20 ℃] |
| form | Powder |
| color | White |
| PH | 9.7-10.3 (1g/l, H2O) |
| Water Solubility | 418g/L at 20℃ |
| BRN | 4165000 |
| InChI | InChI=1S/C8H8O3.Na.H/c1-11-8(10)6-2-4-7(9)5-3-6;;/h2-5,9H,1H3;; |
| InChIKey | PESXGULMKCKJCC-UHFFFAOYSA-M |
| SMILES | C(C1C=CC(O)=CC=1)(=O)OC.[NaH] |
| LogP | -0.63 at 20℃ |
| CAS DataBase Reference | 5026-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | Methylparaben sodium (5026-62-0) |
