| Availability: | |
|---|---|
| PDF Export | |
298-83-9
bosschemical
298-83-9
Nitrotetrazolium blue chloride Basic information | |
Product Name: | Nitrotetrazolium blue chloride |
CAS: | 298-83-9 |
MF: | C40H30ClN10O6+ |
MW: | 782.19 |
EINECS: | 206-067-4 |
Mol File: | 298-83-9.mol |
Nitrotetrazolium blue chloride Chemical Properties | |
Melting point | 200°C |
density | 1.5521 (rough estimate) |
refractive index | 1.7350 (estimate) |
storage temp. | 2-8°C |
solubility | methanol: 50 mg/mL, clear, very strongly yellow |
form | Powder/Solid |
color | Yellow |
PH | 4.5-5.5 |
Water Solubility | Soluble in water, ethanol and methanol. |
λmax | 256 nm |
Sensitive | Light Sensitive |
BRN | 4115923 |
Stability: | Stable, but store cold. |
Biological Applications | Diagnosis of Alzheimer’s disease,bacterial vaginosis,behavioral disturbances in children,Hirschsprung disease; phosphatase assay; phytase assay; detecting bacteria,microorganisms,phosphoinositides,yeast; generating and detecting |
InChIKey | FSVCQIDHPKZJSO-UHFFFAOYSA-L |
SMILES | [Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccc(cc3)[N+]([O-])=O)-c4ccccc4)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccc(cc7)[N+]([O-])=O)-c8ccccc8 |
EPA Substance Registry System | 2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3-(4-nitrophenyl)-5-phenyl-, dichloride (298-83-9) |
Item | Standard | Result |
Appearance | Yellow powder | Yellow powder |
Purity | 98% MIN | 98.25% |
Water | 4.5%MAX | 1.99 |
Solubility (5% methanol) | Yellow transparent solution | Yellow |
TLC | One point | Pass |
