| Availability: | |
|---|---|
| PDF Export | |
25134-21-8
bosschemical
25134-21-8
Methyl-5-norbornene-2,3-dicarboxylic anhydride Basic information | |
Product Name: | Methyl-5-norbornene-2,3-dicarboxylic anhydride |
CAS: | 25134-21-8 |
MF: | C10H10O3 |
MW: | 178.18 |
EINECS: | 246-644-8 |
Mol File: | 25134-21-8.mol |
Methyl-5-norbornene-2,3-dicarboxylic anhydride Chemical Properties | |
Boiling point | 140°C (10 mmHg) |
density | 1.232 g/mL at 25 °C(lit.) |
vapor density | 6.1 (20 °C, vs air) |
vapor pressure | 5 mm Hg ( 120 °C) |
refractive index | n20/D 1.506(lit.) |
Fp | >230 °F |
storage temp. | room temp |
solubility | Miscible with acetone, benzene, naphtha and xylene. |
form | Oily Liquid |
pka | 4.42[at 20 ℃] |
color | Clear light yellow |
biological source | synthetic |
Water Solubility | REACTS |
Sensitive | Moisture Sensitive |
BRN | 162395 |
Major Application | hematology |
histology | |
InChI | 1S/C10H10O3/c1-10-6-3-2-5(4-6)7(10)8(11)13-9(10)12/h2-3,5-7H,4H2,1H3/t5-,6+,7+,10+/m0/s1 |
InChIKey | LTVUCOSIZFEASK-MPXCPUAZSA-N |
SMILES | [H][C@]12C3CC(C(C)=C3)[C@@]1([H])C(=O)OC2=O |
LogP | -4.01 at 20℃ |
CAS DataBase Reference | 25134-21-8(CAS DataBase Reference) |
NIST Chemistry Reference | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydromethyl-(25134-21-8) |
EPA Substance Registry System | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydromethyl-, (3aR,4S,7R,7aS)-rel- (25134-21-8) |
