E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
936563-96-1
bosschem
936563-96-1
| Ibrutinib Basic information | |
| Product Name: | Ibrutinib |
| CAS: | 936563-96-1 |
| MF: | C25H24N6O2 |
| MW: | 440.5 |
| EINECS: | 805-642-2 |
| Mol File: | 936563-96-1.mol |
| Ibrutinib Chemical Properties | |
| Melting point | 153-158°C |
| Boiling point | 715.0±60.0 °C(Predicted) |
| density | 1.34 |
| storage temp. | -20°C |
| solubility | Soluble in DMSO ( up to at least 25 mg/ml) |
| form | solid |
| pka | 4.09±0.30(Predicted) |
| color | White or off-white |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChIKey | XYFPWWZEPKGCCK-GOSISDBHSA-N |
| SMILES | C(N1CCC[C@@H](N2C3C(C(C4=CC=C(OC5=CC=CC=C5)C=C4)=N2)=C(N)N=CN=3)C1)(=O)C=C |
| CAS DataBase Reference | 936563-96-1 |
| Ibrutinib Basic information | |
| Product Name: | Ibrutinib |
| CAS: | 936563-96-1 |
| MF: | C25H24N6O2 |
| MW: | 440.5 |
| EINECS: | 805-642-2 |
| Mol File: | 936563-96-1.mol |
| Ibrutinib Chemical Properties | |
| Melting point | 153-158°C |
| Boiling point | 715.0±60.0 °C(Predicted) |
| density | 1.34 |
| storage temp. | -20°C |
| solubility | Soluble in DMSO ( up to at least 25 mg/ml) |
| form | solid |
| pka | 4.09±0.30(Predicted) |
| color | White or off-white |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChIKey | XYFPWWZEPKGCCK-GOSISDBHSA-N |
| SMILES | C(N1CCC[C@@H](N2C3C(C(C4=CC=C(OC5=CC=CC=C5)C=C4)=N2)=C(N)N=CN=3)C1)(=O)C=C |
| CAS DataBase Reference | 936563-96-1 |
