E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
20150-34-9
bosschemical
20150-34-9
| Ferrous Bisglycinate Basic information | |
| absorption | |
| Product Name: | Ferrous Bisglycinate |
| CAS: | 20150-34-9 |
| MF: | C4H8FeN2O4 |
| MW: | 203.96 |
| EINECS: | 606-444-7 |
| Mol File: | 20150-34-9.mol |
| Ferrous Bisglycinate Chemical Properties | |
| Melting point | >162°C (dec.) |
| Boiling point | 150℃ at 101kPa |
| density | 1.898 at 20℃ |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly) |
| form | Solid |
| color | Pale Brown to Brown |
| Water Solubility | Water: 35.71 mg/mL (176.83 mM) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/2C2H4NO2.Fe/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+4/p-2 |
| InChIKey | MECJLZIFMOMXPW-UHFFFAOYSA-L |
| SMILES | O=C1CN[Fe+2]2(NCC(=O)[O-]2)[O-]1 |
| LogP | -3.47 at 20℃ and pH7 |
| Surface tension | 72.87mN/m at 1g/L and 20℃ |
| Ferrous Bisglycinate Basic information | |
| absorption | |
| Product Name: | Ferrous Bisglycinate |
| CAS: | 20150-34-9 |
| MF: | C4H8FeN2O4 |
| MW: | 203.96 |
| EINECS: | 606-444-7 |
| Mol File: | 20150-34-9.mol |
| Ferrous Bisglycinate Chemical Properties | |
| Melting point | >162°C (dec.) |
| Boiling point | 150℃ at 101kPa |
| density | 1.898 at 20℃ |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly) |
| form | Solid |
| color | Pale Brown to Brown |
| Water Solubility | Water: 35.71 mg/mL (176.83 mM) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/2C2H4NO2.Fe/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+4/p-2 |
| InChIKey | MECJLZIFMOMXPW-UHFFFAOYSA-L |
| SMILES | O=C1CN[Fe+2]2(NCC(=O)[O-]2)[O-]1 |
| LogP | -3.47 at 20℃ and pH7 |
| Surface tension | 72.87mN/m at 1g/L and 20℃ |
