E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
9006-65-9
bosschem
9006-65-9
| Dimethicone Basic information | |
| Product Name: | Dimethicone |
| CAS: | 9006-65-9 |
| MF: | C6H18OSi2 |
| MW: | 162.37752 |
| EINECS: | |
| Mol File: | 9006-65-9.mol |
| Dimethicone Chemical Properties | |
| density | 1 g/mL at 20 °C |
| vapor pressure | 5 mm Hg ( 20 °C) |
| refractive index | n20/D 1.406 |
| Fp | 121 °C |
| storage temp. | Refrigerator |
| solubility | Practically insoluble in water, very slightly soluble or practically insoluble in anhydrous ethanol, miscible with ethyl acetate, with methyl ethyl ketone and with toluene. |
| form | neat |
| color | Colourless |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents, organics, acids, alkalis. Corrodes many metals. |
| InChI | InChI=1S/C6H18OSi2/c1-8(2,3)7-9(4,5)6/h1-6H3 |
| InChIKey | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
| SMILES | O([Si](C)(C)C)[Si](C)(C)C |
| LogP | 3.646 (est) |
| CAS DataBase Reference | 9006-65-9 |
| EPA Substance Registry System | Dimethicone (9006-65-9) |
| Dimethicone Basic information | |
| Product Name: | Dimethicone |
| CAS: | 9006-65-9 |
| MF: | C6H18OSi2 |
| MW: | 162.37752 |
| EINECS: | |
| Mol File: | 9006-65-9.mol |
| Dimethicone Chemical Properties | |
| density | 1 g/mL at 20 °C |
| vapor pressure | 5 mm Hg ( 20 °C) |
| refractive index | n20/D 1.406 |
| Fp | 121 °C |
| storage temp. | Refrigerator |
| solubility | Practically insoluble in water, very slightly soluble or practically insoluble in anhydrous ethanol, miscible with ethyl acetate, with methyl ethyl ketone and with toluene. |
| form | neat |
| color | Colourless |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents, organics, acids, alkalis. Corrodes many metals. |
| InChI | InChI=1S/C6H18OSi2/c1-8(2,3)7-9(4,5)6/h1-6H3 |
| InChIKey | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
| SMILES | O([Si](C)(C)C)[Si](C)(C)C |
| LogP | 3.646 (est) |
| CAS DataBase Reference | 9006-65-9 |
| EPA Substance Registry System | Dimethicone (9006-65-9) |
