| Availability: | |
|---|---|
16919-19-0
bosschemical
16919-19-0
| Ammonium hexafluorosilicate Basic information | |
| Product Name: | Ammonium hexafluorosilicate |
| CAS: | 16919-19-0 |
| MF: | F6H8N2Si |
| MW: | 178.15 |
| EINECS: | 240-968-3 |
| Mol File: | 16919-19-0.mol |
| Ammonium hexafluorosilicate Chemical Properties | |
| Melting point | °Cd ec.) |
| density | 2.01 g/mL at 25 °C(lit.) |
| vapor pressure | 9.99Pa at 20℃ |
| solubility | water solubility 18 g/100 g water. |
| form | Crystalline Powder and Chunks |
| color | White |
| Specific Gravity | 2.011 |
| Water Solubility | Slightly soluble in water. Insoluble in alcohol and acetone. |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| Merck | 14,527 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 |
| NIOSH: IDLH 250 mg/m3; TWA 2.5 mg/m3 | |
| InChI | InChI=1S/F6Si.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2 |
| InChIKey | ITHIMUMYFVCXSL-UHFFFAOYSA-P |
| SMILES | [Si-2](F)(F)(F)(F)(F)F.[NH4+].[NH4+] |
| LogP | -6.01 at 20℃ |
| CAS DataBase Reference | 16919-19-0(CAS DataBase Reference) |
| EPA Substance Registry System | Ammonium silicofluoride (16919-19-0) |


