E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
87120-72-7
bosschem
87120-72-7
| 4-Amino-1-Boc-piperidine Basic information | |
| Product Name: | 4-Amino-1-Boc-piperidine |
| CAS: | 87120-72-7 |
| MF: | C10H20N2O2 |
| MW: | 200.28 |
| EINECS: | 1312995-182-4 |
| Mol File: | 87120-72-7.mol |
| 4-Amino-1-Boc-piperidine Chemical Properties | |
| Melting point | 50°C |
| Boiling point | 80/0.037mm |
| density | 1.041±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.10±0.20(Predicted) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to pale yellow to beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h8H,4-7,11H2,1-3H3 |
| InChIKey | LZRDHSFPLUWYAX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(N)CC1 |
| CAS DataBase Reference | 87120-72-7(CAS DataBase Reference) |
| 4-Amino-1-Boc-piperidine Basic information | |
| Product Name: | 4-Amino-1-Boc-piperidine |
| CAS: | 87120-72-7 |
| MF: | C10H20N2O2 |
| MW: | 200.28 |
| EINECS: | 1312995-182-4 |
| Mol File: | 87120-72-7.mol |
| 4-Amino-1-Boc-piperidine Chemical Properties | |
| Melting point | 50°C |
| Boiling point | 80/0.037mm |
| density | 1.041±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.10±0.20(Predicted) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to pale yellow to beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h8H,4-7,11H2,1-3H3 |
| InChIKey | LZRDHSFPLUWYAX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(N)CC1 |
| CAS DataBase Reference | 87120-72-7(CAS DataBase Reference) |
