E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
1972-28-7
bosschem
1972-28-7
| Diethyl azodicarboxylate Basic information | |
| Product Name: | Diethyl azodicarboxylate |
| Synonyms: | Diazenedicarboxylic acid, diethyl ester;Diethoxycarbonyldiazene;Diethyl (E)-1,2-diazenedicarboxylate;Diethyl diazodicarboxylate;dlethylazodicarboxylate;Ethyl azodicarboxylate;Formic acid, azodi-, diethyl ester;DIETHYL AZODIFORMATE |
| CAS: | 1972-28-7 |
| MF: | C6H10N2O4 |
| MW: | 174.15 |
| EINECS: | 217-821-7 |
| Mol File: | 1972-28-7.mol |
| Diethyl azodicarboxylate Chemical Properties | |
| Melting point | 6°C |
| Boiling point | 106°C (13 mmHg) |
| density | 1.106 |
| refractive index | n20/D 1.47 |
| Fp | 85°C |
| storage temp. | 2-8°C |
| solubility | Miscible with dichloromethane, diethyl ether and toluene. |
| form | liquid |
| color | Clear, orange |
| Sensitive | Air Sensitive |
| BRN | 908662 |
| Stability: | Stable, but may explode if heated under confinement. May be shock sensitive. Decomposes vigorously if heated above 100 C. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. Light sensitive. |
| InChI | InChI=1S/C6H10N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3 |
| InChIKey | FAMRKDQNMBBFBR-FPLPWBNLSA-N |
| SMILES | N(C(OCC)=O)=NC(OCC)=O |
| CAS DataBase Reference | 1972-28-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl azo diformate(1972-28-7) |
| Item | Standard |
| Appearance | Orange Liquid |
| Assay,% | 99% |
| Diethyl azodicarboxylate Basic information | |
| Product Name: | Diethyl azodicarboxylate |
| Synonyms: | Diazenedicarboxylic acid, diethyl ester;Diethoxycarbonyldiazene;Diethyl (E)-1,2-diazenedicarboxylate;Diethyl diazodicarboxylate;dlethylazodicarboxylate;Ethyl azodicarboxylate;Formic acid, azodi-, diethyl ester;DIETHYL AZODIFORMATE |
| CAS: | 1972-28-7 |
| MF: | C6H10N2O4 |
| MW: | 174.15 |
| EINECS: | 217-821-7 |
| Mol File: | 1972-28-7.mol |
| Diethyl azodicarboxylate Chemical Properties | |
| Melting point | 6°C |
| Boiling point | 106°C (13 mmHg) |
| density | 1.106 |
| refractive index | n20/D 1.47 |
| Fp | 85°C |
| storage temp. | 2-8°C |
| solubility | Miscible with dichloromethane, diethyl ether and toluene. |
| form | liquid |
| color | Clear, orange |
| Sensitive | Air Sensitive |
| BRN | 908662 |
| Stability: | Stable, but may explode if heated under confinement. May be shock sensitive. Decomposes vigorously if heated above 100 C. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. Light sensitive. |
| InChI | InChI=1S/C6H10N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3 |
| InChIKey | FAMRKDQNMBBFBR-FPLPWBNLSA-N |
| SMILES | N(C(OCC)=O)=NC(OCC)=O |
| CAS DataBase Reference | 1972-28-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl azo diformate(1972-28-7) |
| Item | Standard |
| Appearance | Orange Liquid |
| Assay,% | 99% |
