| Availability: | |
|---|---|
| PDF Export | |
165450-17-9
bosschem
165450-17-9
| Neotame Basic information | |
| Intensity sweetener Solubility Aspartame Sweetness characteristics Safety and Toxicology | |
| Product Name: | Neotame |
| Synonyms: | Neutame.;NEOTAME (200 MG);NEOTAME;N-(N-(3,3-Dimethylbutyl)-L-alpha-aspartyl)-L-phenylalanine 1-methyl ester;L-PHENYLALANINE, N-[N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL]-, 1-METHYL ESTER;N-[N-(3,3-dimethylbutyl)-L--aspartyl]-L-phenylalanine 1-methyl ester;(S)-3-((3,3-DiMethylbutyl)aMino)-4-(((S)-1-Methoxy-1-oxo-3-phenylpropan-2-yl)aMino)-4-oxobutanoic acid;L-Phenylalanine,N-(3,3-diMethylbutyl)-L-a-aspartyl-,2-Methyl ester |
| CAS: | 165450-17-9 |
| MF: | C20H30N2O5 |
| MW: | 378.46 |
| EINECS: | 605-408-8 |
| Mol File: | 165450-17-9.mol |
| Neotame Chemical Properties | |
| Melting point | 83-85°C |
| alpha | D -54.84° (c = 1 in methanol); D20 -39.8° (c = 0.5 in water) |
| Boiling point | 565.3±50.0 °C(Predicted) |
| density | 1.133±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Ethanol (Sparingly), Ethyl Acetate (Sparingly), Methanol |
| pka | pKa1 3.01; pKa2 8.02(at 25℃) |
| form | neat |
| color | White to Off-White |
| optical activity | [α]/D -41.0±3.0°, c = 0.5 in H2O |
| BRN | 8352678 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16-/s3 |
| InChIKey | HLIAVLHNDJUHFG-HOTGVXAUSA-N |
| SMILES | C(=O)([C@@H](NCCC(C)(C)C)CC(O)=O)N[C@@H](CC1=CC=CC=C1)C(OC)=O |&1:2,15,r| |
| Product name | Neotame |
| CAS | 165450-17-9 |
| Appearance | White powder |
| Assay | 99% |
| Solubility | Sparingly soluble in water |
| Application | Food |
| Function | sweetener,food additives |
| MOQ | 1kg |
| Sample | 10--20g |
| Storage | Cool Dry Place |


| Neotame Basic information | |
| Intensity sweetener Solubility Aspartame Sweetness characteristics Safety and Toxicology | |
| Product Name: | Neotame |
| Synonyms: | Neutame.;NEOTAME (200 MG);NEOTAME;N-(N-(3,3-Dimethylbutyl)-L-alpha-aspartyl)-L-phenylalanine 1-methyl ester;L-PHENYLALANINE, N-[N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL]-, 1-METHYL ESTER;N-[N-(3,3-dimethylbutyl)-L--aspartyl]-L-phenylalanine 1-methyl ester;(S)-3-((3,3-DiMethylbutyl)aMino)-4-(((S)-1-Methoxy-1-oxo-3-phenylpropan-2-yl)aMino)-4-oxobutanoic acid;L-Phenylalanine,N-(3,3-diMethylbutyl)-L-a-aspartyl-,2-Methyl ester |
| CAS: | 165450-17-9 |
| MF: | C20H30N2O5 |
| MW: | 378.46 |
| EINECS: | 605-408-8 |
| Mol File: | 165450-17-9.mol |
| Neotame Chemical Properties | |
| Melting point | 83-85°C |
| alpha | D -54.84° (c = 1 in methanol); D20 -39.8° (c = 0.5 in water) |
| Boiling point | 565.3±50.0 °C(Predicted) |
| density | 1.133±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Ethanol (Sparingly), Ethyl Acetate (Sparingly), Methanol |
| pka | pKa1 3.01; pKa2 8.02(at 25℃) |
| form | neat |
| color | White to Off-White |
| optical activity | [α]/D -41.0±3.0°, c = 0.5 in H2O |
| BRN | 8352678 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16-/s3 |
| InChIKey | HLIAVLHNDJUHFG-HOTGVXAUSA-N |
| SMILES | C(=O)([C@@H](NCCC(C)(C)C)CC(O)=O)N[C@@H](CC1=CC=CC=C1)C(OC)=O |&1:2,15,r| |
| Product name | Neotame |
| CAS | 165450-17-9 |
| Appearance | White powder |
| Assay | 99% |
| Solubility | Sparingly soluble in water |
| Application | Food |
| Function | sweetener,food additives |
| MOQ | 1kg |
| Sample | 10--20g |
| Storage | Cool Dry Place |


