E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
162881-26-7
bosschem
162881-26-7
| Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Basic information | |
| Product Name: | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide |
| Synonyms: | PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)PHOSPHINE OXIDE;Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)-;Photoinitiator 819;Phenylbis(2,4,6-triMethylbenzoyl)phosphine oxide 97%, powder;(Phenylphosphoryl)bis(mesitylmethanone);former IRGACURE 819;OMNIRAD 380;OMNIRAD 819 |
| CAS: | 162881-26-7 |
| MF: | C26H27O3P |
| MW: | 418.47 |
| EINECS: | 423-340-5 |
| Mol File: | 162881-26-7.mol |
| Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Chemical Properties | |
| Melting point | 131-135 °C(lit.) |
| Boiling point | 590.0±60.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone, acetonitrile, toluene, and hexanedioldiacrylate: soluble |
| form | powder |
| color | Pale Yellow to Yellow |
| Water Solubility | 100μg/L at 20-21℃ |
| λmax | 366nm(MeOH)(lit.) |
| InChI | InChI=1S/C26H27O3P/c1-16-12-18(3)23(19(4)13-16)25(27)30(29,22-10-8-7-9-11-22)26(28)24-20(5)14-17(2)15-21(24)6/h7-15H,1-6H3 |
| InChIKey | GUCYFKSBFREPBC-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(=O)(C(C1C(=CC(C)=CC=1C)C)=O)C(C1C(=CC(C)=CC=1C)C)=O |
| LogP | 5.77-5.8 at 22℃ |
| CAS DataBase Reference | 162881-26-7 |
| EPA Substance Registry System | Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)- (162881-26-7) |
| Items | Standard |
| Appearance | Pale yellow powder |
| Assay | ≥98.5% |
| Melting point | 127.0℃~135.0℃ |
| Loss on drying | ≤0.2% |
| Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Basic information | |
| Product Name: | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide |
| Synonyms: | PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)PHOSPHINE OXIDE;Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)-;Photoinitiator 819;Phenylbis(2,4,6-triMethylbenzoyl)phosphine oxide 97%, powder;(Phenylphosphoryl)bis(mesitylmethanone);former IRGACURE 819;OMNIRAD 380;OMNIRAD 819 |
| CAS: | 162881-26-7 |
| MF: | C26H27O3P |
| MW: | 418.47 |
| EINECS: | 423-340-5 |
| Mol File: | 162881-26-7.mol |
| Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Chemical Properties | |
| Melting point | 131-135 °C(lit.) |
| Boiling point | 590.0±60.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone, acetonitrile, toluene, and hexanedioldiacrylate: soluble |
| form | powder |
| color | Pale Yellow to Yellow |
| Water Solubility | 100μg/L at 20-21℃ |
| λmax | 366nm(MeOH)(lit.) |
| InChI | InChI=1S/C26H27O3P/c1-16-12-18(3)23(19(4)13-16)25(27)30(29,22-10-8-7-9-11-22)26(28)24-20(5)14-17(2)15-21(24)6/h7-15H,1-6H3 |
| InChIKey | GUCYFKSBFREPBC-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(=O)(C(C1C(=CC(C)=CC=1C)C)=O)C(C1C(=CC(C)=CC=1C)C)=O |
| LogP | 5.77-5.8 at 22℃ |
| CAS DataBase Reference | 162881-26-7 |
| EPA Substance Registry System | Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)- (162881-26-7) |
| Items | Standard |
| Appearance | Pale yellow powder |
| Assay | ≥98.5% |
| Melting point | 127.0℃~135.0℃ |
| Loss on drying | ≤0.2% |
