E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
143-24-8
bosschem
143-24-8
| Tetraethylene glycol dimethyl ether Basic information | |
| Product Name: | Tetraethylene glycol dimethyl ether |
| Synonyms: | TETRA(ETHYLENE GLYCOL) DIMETHYL ETHER, 9 9+%;TETRAETHYLENE GLYCOL DIMETHYL ETHER,STAN DARD FOR GC;Tetraethylene glycol dimethyl ether, 98+%;2,5,8,11,14-Pentaoxapentadecane, Bis[2-(2-methoxyethoxy)ethyl] ether, Dimethoxytetraethylene glycol, Dimethyltetraglycol, Tetraglyme;Tetraethylene glycol dimethyl ether, 99%, extra pure;Tetraethylene glycol dimethyl ether, extra pure;1-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)-ethoxy]-ethane;1,11-dimethoxy-3,6,9-trioxa-undecane |
| CAS: | 143-24-8 |
| MF: | C10H22O5 |
| MW: | 222.28 |
| EINECS: | 205-594-7 |
| Mol File: | 143-24-8.mol |
| Tetraethylene glycol dimethyl ether Chemical Properties | |
| Melting point | -30 °C (lit.) |
| Boiling point | 275-276 °C (lit.) |
| density | 1.009 g/mL at 25 °C (lit.) |
| vapor density | 7.7 (vs air) |
| vapor pressure | <0.01 mm Hg ( 20 °C) |
| refractive index | n20/D 1.432(lit.) |
| Fp | 285 °F |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear |
| Specific Gravity | 1.01 |
| explosive limit | 0.8%(V) |
| Water Solubility | Soluble |
| Merck | 149,208 |
| BRN | 1760005 |
| InChIKey | ZUHZGEOKBKGPSW-UHFFFAOYSA-N |
| LogP | -0.84 at 23℃ |
| CAS DataBase Reference | 143-24-8(CAS DataBase Reference) |
| NIST Chemistry Reference | CH3O[CH2CH2O]4CH3(143-24-8) |
| EPA Substance Registry System | Tetraglyme (143-24-8) |
| items | index |
| content% | ≥99.5% |
| color tone(APHA) | 10 MAX |
| index of retraction(nD20) | 1.433-1.435 |
| moisure% | ≤0.2 |
| free acid(as CH3OOH%) ppm | ≤75 |
| ash ppm | ≤80 |
| Tetraethylene glycol dimethyl ether Basic information | |
| Product Name: | Tetraethylene glycol dimethyl ether |
| Synonyms: | TETRA(ETHYLENE GLYCOL) DIMETHYL ETHER, 9 9+%;TETRAETHYLENE GLYCOL DIMETHYL ETHER,STAN DARD FOR GC;Tetraethylene glycol dimethyl ether, 98+%;2,5,8,11,14-Pentaoxapentadecane, Bis[2-(2-methoxyethoxy)ethyl] ether, Dimethoxytetraethylene glycol, Dimethyltetraglycol, Tetraglyme;Tetraethylene glycol dimethyl ether, 99%, extra pure;Tetraethylene glycol dimethyl ether, extra pure;1-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)-ethoxy]-ethane;1,11-dimethoxy-3,6,9-trioxa-undecane |
| CAS: | 143-24-8 |
| MF: | C10H22O5 |
| MW: | 222.28 |
| EINECS: | 205-594-7 |
| Mol File: | 143-24-8.mol |
| Tetraethylene glycol dimethyl ether Chemical Properties | |
| Melting point | -30 °C (lit.) |
| Boiling point | 275-276 °C (lit.) |
| density | 1.009 g/mL at 25 °C (lit.) |
| vapor density | 7.7 (vs air) |
| vapor pressure | <0.01 mm Hg ( 20 °C) |
| refractive index | n20/D 1.432(lit.) |
| Fp | 285 °F |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear |
| Specific Gravity | 1.01 |
| explosive limit | 0.8%(V) |
| Water Solubility | Soluble |
| Merck | 149,208 |
| BRN | 1760005 |
| InChIKey | ZUHZGEOKBKGPSW-UHFFFAOYSA-N |
| LogP | -0.84 at 23℃ |
| CAS DataBase Reference | 143-24-8(CAS DataBase Reference) |
| NIST Chemistry Reference | CH3O[CH2CH2O]4CH3(143-24-8) |
| EPA Substance Registry System | Tetraglyme (143-24-8) |
| items | index |
| content% | ≥99.5% |
| color tone(APHA) | 10 MAX |
| index of retraction(nD20) | 1.433-1.435 |
| moisure% | ≤0.2 |
| free acid(as CH3OOH%) ppm | ≤75 |
| ash ppm | ≤80 |
