E-mail: sales001@bosschemical.com JINAN BOSS CHEM CO.,LTD
Telephone: +86-15628782329
| PDF Export | |
678-39-7
bosschemical
678-39-7
 1H,1H,2H,2H-Perfluoro-1-decanol Basic information | |
| Product Name: | 1H,1H,2H,2H-Perfluoro-1-decanol |
| CAS: | 678-39-7 |
| MF: | C10H5F17O |
| MW: | 464.12 |
| EINECS: | 211-648-0 |
| Mol File: | 678-39-7.mol |
| 1H,1H,2H,2H-Perfluoro-1-decanol Chemical Properties | |
| Melting point | 50 °C |
| Boiling point | 113°C 10mm |
| density | 1.633±0.06 g/cm3(Predicted) |
| Fp | None |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform and methanol. |
| pka | 14.28±0.10(Predicted) |
| form | solid |
| color | tan |
| BRN | 2227487 |
| InChI | InChI=1S/C10H5F17O/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h28H,1-2H2 |
| InChIKey | JJUBFBTUBACDHW-UHFFFAOYSA-N |
| SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 678-39-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- (678-39-7) |
| 1H,1H,2H,2H-Perfluoro-1-decanol Basic information | |
| Product Name: | 1H,1H,2H,2H-Perfluoro-1-decanol |
| CAS: | 678-39-7 |
| MF: | C10H5F17O |
| MW: | 464.12 |
| EINECS: | 211-648-0 |
| Mol File: | 678-39-7.mol |
| 1H,1H,2H,2H-Perfluoro-1-decanol Chemical Properties | |
| Melting point | 50 °C |
| Boiling point | 113°C 10mm |
| density | 1.633±0.06 g/cm3(Predicted) |
| Fp | None |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform and methanol. |
| pka | 14.28±0.10(Predicted) |
| form | solid |
| color | tan |
| BRN | 2227487 |
| InChI | InChI=1S/C10H5F17O/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h28H,1-2H2 |
| InChIKey | JJUBFBTUBACDHW-UHFFFAOYSA-N |
| SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 678-39-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- (678-39-7) |
